C25H35NO3 — CID 68733014
[(10R,13S,17S)-17-ethyl-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] N-prop-2-enylcarbamate (PubChem CID 68733014) has the molecular formula C25H35NO3 and a molecular weight of 397.56 g/mol. Its IUPAC name is [(10R,13S,17S)-17-ethyl-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] N-prop-2-enylcarbamate.
| Compound Name | [(10R,13S,17S)-17-ethyl-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 68733014 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | [(10R,13S,17S)-17-ethyl-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] N-prop-2-enylcarbamate |
| SMILES | C=CCNC(=O)O[C@@]1(CC)CCC2C3CCC4=CC(=O)C=C[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C25H35NO3/c1-5-15-26-22(28)29-25(6-2)14-11-21-19-8-7-17-16-18(27)9-12-23(17,3)20(19)10-13-24(21,25)4/h5,9,12,16,19-21H,1,6-8,10-11,13-15H2,2-4H3,(H,26,28)/t19?,20?,21?,23-,24-,25-/m0/s1 |
| InChIKey | NMEFNGVLCNSKCU-DWSVNQEMSA-N |
| XLogP | 5.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|