C27H41NO3 — CID 68718237
[(10R,13S,17S)-17-ethyl-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] N-pentylcarbamate (PubChem CID 68718237) has the molecular formula C27H41NO3 and a molecular weight of 427.63 g/mol. Its IUPAC name is [(10R,13S,17S)-17-ethyl-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] N-pentylcarbamate.
| Compound Name | [(10R,13S,17S)-17-ethyl-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] N-pentylcarbamate |
|---|---|
| PubChem CID | 68718237 |
| Molecular Formula | C27H41NO3 |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 427.31 |
| IUPAC Name | [(10R,13S,17S)-17-ethyl-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] N-pentylcarbamate |
| SMILES | CCCCCNC(=O)O[C@@]1(CC)CCC2C3CCC4=CC(=O)C=C[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C27H41NO3/c1-5-7-8-17-28-24(30)31-27(6-2)16-13-23-21-10-9-19-18-20(29)11-14-25(19,3)22(21)12-15-26(23,27)4/h11,14,18,21-23H,5-10,12-13,15-17H2,1-4H3,(H,28,30)/t21?,22?,23?,25-,26-,27-/m0/s1 |
| InChIKey | DNDPJFANQZUGBM-JKPPDDDBSA-N |
| XLogP | 6.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|