C27H44O — CID 164574355
but-1-ene;ethane;10,13,17,17-tetramethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 164574355) has the molecular formula C27H44O and a molecular weight of 384.65 g/mol. Its IUPAC name is but-1-ene;ethane;10,13,17,17-tetramethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | but-1-ene;ethane;10,13,17,17-tetramethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 164574355 |
| Molecular Formula | C27H44O |
| Molecular Weight | 384.65 g/mol |
| Exact Mass | 384.34 |
| IUPAC Name | but-1-ene;ethane;10,13,17,17-tetramethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | C=CCC.CC.CC12C=CC(=O)C=C1CCC1C2CCC2(C)C1CCC2(C)C |
| InChI | InChI=1S/C21H30O.C4H8.C2H6/c1-19(2)10-8-18-16-6-5-14-13-15(22)7-11-20(14,3)17(16)9-12-21(18,19)4;1-3-4-2;1-2/h7,11,13,16-18H,5-6,8-10,12H2,1-4H3;3H,1,4H2,2H3;1-2H3 |
| InChIKey | HSZPIZCXQSFRER-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.65 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|