C27H32O4 — CID 56634248
(8R,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-17-(2-phenoxyoxiran-2-yl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 56634248) has the molecular formula C27H32O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-17-(2-phenoxyoxiran-2-yl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-17-(2-phenoxyoxiran-2-yl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 56634248 |
| Molecular Formula | C27H32O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | (8R,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-17-(2-phenoxyoxiran-2-yl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CCC2(O)C1(Oc2ccccc2)CO1 |
| InChI | InChI=1S/C27H32O4/c1-24-13-10-19(28)16-18(24)8-9-21-22(24)11-14-25(2)23(21)12-15-26(25,29)27(17-30-27)31-20-6-4-3-5-7-20/h3-7,10,13,16,21-23,29H,8-9,11-12,14-15,17H2,1-2H3/t21-,22+,23+,24+,25+,26?,27?/m1/s1 |
| InChIKey | MATAZYYHCHVTKP-DEIPPDSNSA-N |
| XLogP | 4.83 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|