C27H32O4 — CID 88682489
(8S,9S,10R,13S,14S,17S)-17-(3-hydroxy-2-phenoxyoxiran-2-yl)-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 88682489) has the molecular formula C27H32O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-17-(3-hydroxy-2-phenoxyoxiran-2-yl)-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S,17S)-17-(3-hydroxy-2-phenoxyoxiran-2-yl)-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 88682489 |
| Molecular Formula | C27H32O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-17-(3-hydroxy-2-phenoxyoxiran-2-yl)-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@]2(C)C(C3(Oc4ccccc4)OC3O)CC[C@@H]12 |
| InChI | InChI=1S/C27H32O4/c1-25-14-12-18(28)16-17(25)8-9-20-21-10-11-23(26(21,2)15-13-22(20)25)27(24(29)31-27)30-19-6-4-3-5-7-19/h3-7,12,14,16,20-24,29H,8-11,13,15H2,1-2H3/t20-,21-,22-,23?,24?,25-,26-,27?/m0/s1 |
| InChIKey | MIFZRMVCZXLQGM-LNNIHPJMSA-N |
| XLogP | 5.03 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|