C24H32O — CID 54258711
(10R,13S,17S)-10,13-dimethyl-17-penta-2,3-dien-2-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 54258711) has the molecular formula C24H32O and a molecular weight of 336.52 g/mol. Its IUPAC name is (10R,13S,17S)-10,13-dimethyl-17-penta-2,3-dien-2-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (10R,13S,17S)-10,13-dimethyl-17-penta-2,3-dien-2-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 54258711 |
| Molecular Formula | C24H32O |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | (10R,13S,17S)-10,13-dimethyl-17-penta-2,3-dien-2-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC=C=C(C)[C@H]1CCC2C3CCC4=CC(=O)C=C[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C24H32O/c1-5-6-16(2)20-9-10-21-19-8-7-17-15-18(25)11-13-23(17,3)22(19)12-14-24(20,21)4/h5,11,13,15,19-22H,7-10,12,14H2,1-4H3/t6?,19?,20-,21?,22?,23+,24-/m1/s1 |
| InChIKey | RBYHBDJZVUEFFP-FYYOQSRKSA-N |
| XLogP | 6.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |