C25H34O5 — CID 141078510
[2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-1-hydroxy-2-oxoethyl] 2-methylpropanoate (PubChem CID 141078510) has the molecular formula C25H34O5 and a molecular weight of 414.54 g/mol. Its IUPAC name is [2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-1-hydroxy-2-oxoethyl] 2-methylpropanoate.
| Compound Name | [2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-1-hydroxy-2-oxoethyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 141078510 |
| Molecular Formula | C25H34O5 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | [2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-1-hydroxy-2-oxoethyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC(O)C(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H34O5/c1-14(2)22(28)30-23(29)21(27)20-8-7-18-17-6-5-15-13-16(26)9-11-24(15,3)19(17)10-12-25(18,20)4/h9,11,13-14,17-20,23,29H,5-8,10,12H2,1-4H3/t17-,18-,19-,20+,23?,24-,25-/m0/s1 |
| InChIKey | IHFIDUIDCKSKEC-MLNBAVJMSA-N |
| XLogP | 4.00 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|