C26H31NO3 — CID 143830247
10,13-dimethyl-17-(2-pyridin-3-yloxyacetyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 143830247) has the molecular formula C26H31NO3 and a molecular weight of 405.54 g/mol. Its IUPAC name is 10,13-dimethyl-17-(2-pyridin-3-yloxyacetyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 10,13-dimethyl-17-(2-pyridin-3-yloxyacetyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 143830247 |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 10,13-dimethyl-17-(2-pyridin-3-yloxyacetyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC12C=CC(=O)C=C1CCC1C2CCC2(C)C(C(=O)COc3cccnc3)CCC12 |
| InChI | InChI=1S/C26H31NO3/c1-25-11-9-18(28)14-17(25)5-6-20-21-7-8-23(26(21,2)12-10-22(20)25)24(29)16-30-19-4-3-13-27-15-19/h3-4,9,11,13-15,20-23H,5-8,10,12,16H2,1-2H3 |
| InChIKey | CMFXMKPEIYQSHL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |