C24H36O2 — CID 142421265
17-but-1-en-2-yl-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one;methanol (PubChem CID 142421265) has the molecular formula C24H36O2 and a molecular weight of 356.55 g/mol. Its IUPAC name is 17-but-1-en-2-yl-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one;methanol.
| Compound Name | 17-but-1-en-2-yl-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one;methanol |
|---|---|
| PubChem CID | 142421265 |
| Molecular Formula | C24H36O2 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 17-but-1-en-2-yl-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one;methanol |
| SMILES | C=C(CC)C1CCC2C3CCC4=CC(=O)C=CC4(C)C3CCC12C.CO |
| InChI | InChI=1S/C23H32O.CH4O/c1-5-15(2)19-8-9-20-18-7-6-16-14-17(24)10-12-22(16,3)21(18)11-13-23(19,20)4;1-2/h10,12,14,18-21H,2,5-9,11,13H2,1,3-4H3;2H,1H3 |
| InChIKey | FKCOKBFMMBWBEU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|