C24H38 — CID 176925479
17-but-1-en-2-yl-10,13-dimethyl-3-methylidene-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene;molecular hydrogen (PubChem CID 176925479) has the molecular formula C24H38 and a molecular weight of 326.57 g/mol. Its IUPAC name is 17-but-1-en-2-yl-10,13-dimethyl-3-methylidene-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene;molecular hydrogen.
| Compound Name | 17-but-1-en-2-yl-10,13-dimethyl-3-methylidene-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene;molecular hydrogen |
|---|---|
| PubChem CID | 176925479 |
| Molecular Formula | C24H38 |
| Molecular Weight | 326.57 g/mol |
| Exact Mass | 326.30 |
| IUPAC Name | 17-but-1-en-2-yl-10,13-dimethyl-3-methylidene-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene;molecular hydrogen |
| SMILES | C=C1C=C2CCC3C(CCC4(C)C(C(=C)CC)CCC34)C2(C)CC1.[H][H] |
| InChI | InChI=1S/C24H36.H2/c1-6-17(3)20-9-10-21-19-8-7-18-15-16(2)11-13-23(18,4)22(19)12-14-24(20,21)5;/h15,19-22H,2-3,6-14H2,1,4-5H3;1H |
| InChIKey | SDFQGGKRORONJI-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.57 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|