C22H34 — CID 162357955
(10R,13R,17S)-17-ethyl-10,13-dimethyl-3-methylidene-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene (PubChem CID 162357955) has the molecular formula C22H34 and a molecular weight of 298.51 g/mol. Its IUPAC name is (10R,13R,17S)-17-ethyl-10,13-dimethyl-3-methylidene-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene.
| Compound Name | (10R,13R,17S)-17-ethyl-10,13-dimethyl-3-methylidene-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 162357955 |
| Molecular Formula | C22H34 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | (10R,13R,17S)-17-ethyl-10,13-dimethyl-3-methylidene-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene |
| SMILES | C=C1C=C2CCC3C(CC[C@@]4(C)C3CC[C@@H]4CC)[C@@]2(C)CC1 |
| InChI | InChI=1S/C22H34/c1-5-16-7-9-19-18-8-6-17-14-15(2)10-12-22(17,4)20(18)11-13-21(16,19)3/h14,16,18-20H,2,5-13H2,1,3-4H3/t16-,18?,19?,20?,21+,22-/m0/s1 |
| InChIKey | RIKZQXUODXPEFS-UHQFVNPMSA-N |
| XLogP | 6.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |