C22H33NO — CID 142417136
(E)-N-ethoxy-10,13-dimethyl-3-methylidene-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-imine (PubChem CID 142417136) has the molecular formula C22H33NO and a molecular weight of 327.51 g/mol. Its IUPAC name is (E)-N-ethoxy-10,13-dimethyl-3-methylidene-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-imine.
| Compound Name | (E)-N-ethoxy-10,13-dimethyl-3-methylidene-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-imine |
|---|---|
| PubChem CID | 142417136 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | (E)-N-ethoxy-10,13-dimethyl-3-methylidene-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-imine |
| SMILES | C=C1C=C2CCC3C(CCC4(C)/C(=N/OCC)CCC34)C2(C)CC1 |
| InChI | InChI=1S/C22H33NO/c1-5-24-23-20-9-8-18-17-7-6-16-14-15(2)10-12-21(16,3)19(17)11-13-22(18,20)4/h14,17-19H,2,5-13H2,1,3-4H3/b23-20+ |
| InChIKey | UKLUMROHQLLYTE-BSYVCWPDSA-N |
| XLogP | 5.90 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|