C21H32N2O2 — CID 91743381
(8R,9S,10R,13S,14S)-3-N,17-N-dimethoxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-diimine (PubChem CID 91743381) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-3-N,17-N-dimethoxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-diimine.
| Compound Name | (8R,9S,10R,13S,14S)-3-N,17-N-dimethoxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-diimine |
|---|---|
| PubChem CID | 91743381 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | (8R,9S,10R,13S,14S)-3-N,17-N-dimethoxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-diimine |
| SMILES | CO/N=C1/C=C2CC[C@@H]3[C@H](CC[C@]4(C)/C(=N/OC)CC[C@@H]34)[C@@]2(C)CC1 |
| InChI | InChI=1S/C21H32N2O2/c1-20-11-9-15(22-24-3)13-14(20)5-6-16-17-7-8-19(23-25-4)21(17,2)12-10-18(16)20/h13,16-18H,5-12H2,1-4H3/b22-15+,23-19+/t16-,17-,18-,20-,21-/m0/s1 |
| InChIKey | ZZDSWSPDFBFXIQ-WCYYPPGVSA-N |
| XLogP | 4.95 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|