C26H39NO2 — CID 24895689
1-[(2E,4aR,4bS,6aS,6bS,10aR,11aS,11bR)-2-methoxyimino-4a,6a-dimethyl-4,4b,5,6,7,8,9,10,10a,11,11a,11b,12,13-tetradecahydro-3H-indeno[2,1-a]phenanthren-6b-yl]ethanone (PubChem CID 24895689) has the molecular formula C26H39NO2 and a molecular weight of 397.60 g/mol. Its IUPAC name is 1-[(2E,4aR,4bS,6aS,6bS,10aR,11aS,11bR)-2-methoxyimino-4a,6a-dimethyl-4,4b,5,6,7,8,9,10,10a,11,11a,11b,12,13-tetradecahydro-3H-indeno[2,1-a]phenanthren-6b-yl]ethanone.
| Compound Name | 1-[(2E,4aR,4bS,6aS,6bS,10aR,11aS,11bR)-2-methoxyimino-4a,6a-dimethyl-4,4b,5,6,7,8,9,10,10a,11,11a,11b,12,13-tetradecahydro-3H-indeno[2,1-a]phenanthren-6b-yl]ethanone |
|---|---|
| PubChem CID | 24895689 |
| Molecular Formula | C26H39NO2 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.30 |
| IUPAC Name | 1-[(2E,4aR,4bS,6aS,6bS,10aR,11aS,11bR)-2-methoxyimino-4a,6a-dimethyl-4,4b,5,6,7,8,9,10,10a,11,11a,11b,12,13-tetradecahydro-3H-indeno[2,1-a]phenanthren-6b-yl]ethanone |
| SMILES | CO/N=C1/C=C2CC[C@@H]3[C@H](CC[C@@]4(C)[C@H]3C[C@H]3CCCC[C@]34C(C)=O)[C@@]2(C)CC1 |
| InChI | InChI=1S/C26H39NO2/c1-17(28)26-12-6-5-7-19(26)16-23-21-9-8-18-15-20(27-29-4)10-13-24(18,2)22(21)11-14-25(23,26)3/h15,19,21-23H,5-14,16H2,1-4H3/b27-20+/t19-,21-,22+,23+,24+,25+,26+/m1/s1 |
| InChIKey | CTVOPPAULYUILQ-GZKDOEDLSA-N |
| XLogP | 6.33 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|