C23H39NO2Si — CID 20845874
(Z,8R,9S,10R,13S,14S)-N-methoxy-10,13-dimethyl-17-trimethylsilyloxy-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-imine (PubChem CID 20845874) has the molecular formula C23H39NO2Si and a molecular weight of 389.66 g/mol. Its IUPAC name is (Z,8R,9S,10R,13S,14S)-N-methoxy-10,13-dimethyl-17-trimethylsilyloxy-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-imine.
| Compound Name | (Z,8R,9S,10R,13S,14S)-N-methoxy-10,13-dimethyl-17-trimethylsilyloxy-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-imine |
|---|---|
| PubChem CID | 20845874 |
| Molecular Formula | C23H39NO2Si |
| Molecular Weight | 389.66 g/mol |
| Exact Mass | 389.28 |
| IUPAC Name | (Z,8R,9S,10R,13S,14S)-N-methoxy-10,13-dimethyl-17-trimethylsilyloxy-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-imine |
| SMILES | CO/N=C1\C=C2CC[C@@H]3[C@H](CC[C@]4(C)C(O[Si](C)(C)C)CC[C@@H]34)[C@@]2(C)CC1 |
| InChI | InChI=1S/C23H39NO2Si/c1-22-13-11-17(24-25-3)15-16(22)7-8-18-19-9-10-21(26-27(4,5)6)23(19,2)14-12-20(18)22/h15,18-21H,7-14H2,1-6H3/b24-17-/t18-,19-,20-,21?,22-,23-/m0/s1 |
| InChIKey | SFXUCUOVEDBETC-QZMFBDKMSA-N |
| XLogP | 6.17 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.66 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|