C31H53NO3Si — CID 91750733
trimethylsilyl 6-[(3E,10R,13R,17R)-3-methoxyimino-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-methylheptanoate (PubChem CID 91750733) has the molecular formula C31H53NO3Si and a molecular weight of 515.86 g/mol. Its IUPAC name is trimethylsilyl 6-[(3E,10R,13R,17R)-3-methoxyimino-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-methylheptanoate.
| Compound Name | trimethylsilyl 6-[(3E,10R,13R,17R)-3-methoxyimino-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-methylheptanoate |
|---|---|
| PubChem CID | 91750733 |
| Molecular Formula | C31H53NO3Si |
| Molecular Weight | 515.86 g/mol |
| Exact Mass | 515.38 |
| IUPAC Name | trimethylsilyl 6-[(3E,10R,13R,17R)-3-methoxyimino-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-methylheptanoate |
| SMILES | CO/N=C1/C=C2CCC3C(CC[C@@]4(C)C3CC[C@@H]4C(C)CCCC(C)C(=O)O[Si](C)(C)C)[C@@]2(C)CC1 |
| InChI | InChI=1S/C31H53NO3Si/c1-21(10-9-11-22(2)29(33)35-36(6,7)8)26-14-15-27-25-13-12-23-20-24(32-34-5)16-18-30(23,3)28(25)17-19-31(26,27)4/h20-22,25-28H,9-19H2,1-8H3/b32-24+/t21?,22?,25?,26-,27?,28?,30+,31-/m1/s1 |
| InChIKey | HOMDZWFYFIHOMY-OYELAKRJSA-N |
| XLogP | 8.39 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.86 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|