C31H55NO4Si2 — CID 91750724
trimethylsilyl 4-[(3E,7R,10R,13R,17R)-3-methoxyimino-10,13-dimethyl-7-trimethylsilyloxy-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 91750724) has the molecular formula C31H55NO4Si2 and a molecular weight of 561.96 g/mol. Its IUPAC name is trimethylsilyl 4-[(3E,7R,10R,13R,17R)-3-methoxyimino-10,13-dimethyl-7-trimethylsilyloxy-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | trimethylsilyl 4-[(3E,7R,10R,13R,17R)-3-methoxyimino-10,13-dimethyl-7-trimethylsilyloxy-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 91750724 |
| Molecular Formula | C31H55NO4Si2 |
| Molecular Weight | 561.96 g/mol |
| Exact Mass | 561.37 |
| IUPAC Name | trimethylsilyl 4-[(3E,7R,10R,13R,17R)-3-methoxyimino-10,13-dimethyl-7-trimethylsilyloxy-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | CO/N=C1/C=C2CC(O[Si](C)(C)C)C3C(CC[C@@]4(C)C3CC[C@@H]4C(C)CCC(=O)O[Si](C)(C)C)[C@@]2(C)CC1 |
| InChI | InChI=1S/C31H55NO4Si2/c1-21(11-14-28(33)36-38(8,9)10)24-12-13-25-29-26(16-18-31(24,25)3)30(2)17-15-23(32-34-4)19-22(30)20-27(29)35-37(5,6)7/h19,21,24-27,29H,11-18,20H2,1-10H3/b32-23+/t21?,24-,25?,26?,27?,29?,30+,31-/m1/s1 |
| InChIKey | QOTVZIAXEYHVPF-OBBUVTMASA-N |
| XLogP | 8.19 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.96 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|