C33H64O4Si3 — CID 6430620
trimethylsilyl 4-[(3R,7S)-10,13-dimethyl-3,7-bis(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 6430620) has the molecular formula C33H64O4Si3 and a molecular weight of 609.13 g/mol. Its IUPAC name is trimethylsilyl 4-[(3R,7S)-10,13-dimethyl-3,7-bis(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | trimethylsilyl 4-[(3R,7S)-10,13-dimethyl-3,7-bis(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 6430620 |
| Molecular Formula | C33H64O4Si3 |
| Molecular Weight | 609.13 g/mol |
| Exact Mass | 608.41 |
| IUPAC Name | trimethylsilyl 4-[(3R,7S)-10,13-dimethyl-3,7-bis(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | CC(CCC(=O)O[Si](C)(C)C)C1CCC2C3C(O[Si](C)(C)C)CC4C[C@H](O[Si](C)(C)C)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C33H64O4Si3/c1-23(13-16-30(34)37-40(10,11)12)26-14-15-27-31-28(18-20-33(26,27)3)32(2)19-17-25(35-38(4,5)6)21-24(32)22-29(31)36-39(7,8)9/h23-29,31H,13-22H2,1-12H3/t23?,24?,25-,26?,27?,28?,29?,31?,32?,33?/m1/s1 |
| InChIKey | TUMUEXLHVCPQOP-UWNYEOPBSA-N |
| XLogP | 9.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.13 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|