C36H72O5Si4 — CID 91747849
trimethylsilyl 4-[(3R,7S,14R)-10,13-dimethyl-3,7,14-tris(trimethylsilyloxy)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 91747849) has the molecular formula C36H72O5Si4 and a molecular weight of 697.31 g/mol. Its IUPAC name is trimethylsilyl 4-[(3R,7S,14R)-10,13-dimethyl-3,7,14-tris(trimethylsilyloxy)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | trimethylsilyl 4-[(3R,7S,14R)-10,13-dimethyl-3,7,14-tris(trimethylsilyloxy)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 91747849 |
| Molecular Formula | C36H72O5Si4 |
| Molecular Weight | 697.31 g/mol |
| Exact Mass | 696.45 |
| IUPAC Name | trimethylsilyl 4-[(3R,7S,14R)-10,13-dimethyl-3,7,14-tris(trimethylsilyloxy)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | CC(CCC(=O)O[Si](C)(C)C)C1CC[C@@]2(O[Si](C)(C)C)C3C(O[Si](C)(C)C)CC4C[C@H](O[Si](C)(C)C)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C36H72O5Si4/c1-26(16-17-32(37)40-44(10,11)12)29-20-23-36(41-45(13,14)15)33-30(19-22-35(29,36)3)34(2)21-18-28(38-42(4,5)6)24-27(34)25-31(33)39-43(7,8)9/h26-31,33H,16-25H2,1-15H3/t26?,27?,28-,29?,30?,31?,33?,34?,35?,36-/m1/s1 |
| InChIKey | FXIHTYHJAIHHNY-FQFDAPDJSA-N |
| XLogP | 10.46 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.31 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|