C34H66O5Si3 — CID 137325384
methyl (4R)-4-[(3R,6S,10R,13R)-10,13-dimethyl-3,6,7-tris(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 137325384) has the molecular formula C34H66O5Si3 and a molecular weight of 639.16 g/mol. Its IUPAC name is methyl (4R)-4-[(3R,6S,10R,13R)-10,13-dimethyl-3,6,7-tris(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(3R,6S,10R,13R)-10,13-dimethyl-3,6,7-tris(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 137325384 |
| Molecular Formula | C34H66O5Si3 |
| Molecular Weight | 639.16 g/mol |
| Exact Mass | 638.42 |
| IUPAC Name | methyl (4R)-4-[(3R,6S,10R,13R)-10,13-dimethyl-3,6,7-tris(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)C1CCC2C3C(O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C4C[C@H](O[Si](C)(C)C)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C34H66O5Si3/c1-23(14-17-29(35)36-4)25-15-16-26-30-27(19-21-33(25,26)2)34(3)20-18-24(37-40(5,6)7)22-28(34)31(38-41(8,9)10)32(30)39-42(11,12)13/h23-28,30-32H,14-22H2,1-13H3/t23-,24-,25?,26?,27?,28?,30?,31+,32?,33-,34-/m1/s1 |
| InChIKey | MPBUWUAYSDIDGN-OMWBIXPJSA-N |
| XLogP | 9.11 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.16 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|