C34H66O5Si3 — CID 91750753
methyl 4-[(3S,4R,5S,7R,10R,13R,17R)-10,13-dimethyl-3,4,7-tris(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 91750753) has the molecular formula C34H66O5Si3 and a molecular weight of 639.16 g/mol. Its IUPAC name is methyl 4-[(3S,4R,5S,7R,10R,13R,17R)-10,13-dimethyl-3,4,7-tris(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl 4-[(3S,4R,5S,7R,10R,13R,17R)-10,13-dimethyl-3,4,7-tris(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 91750753 |
| Molecular Formula | C34H66O5Si3 |
| Molecular Weight | 639.16 g/mol |
| Exact Mass | 638.42 |
| IUPAC Name | methyl 4-[(3S,4R,5S,7R,10R,13R,17R)-10,13-dimethyl-3,4,7-tris(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CCC(C)[C@H]1CCC2C3C(O[Si](C)(C)C)C[C@@H]4[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C34H66O5Si3/c1-23(14-17-30(35)36-4)24-15-16-25-31-26(18-20-33(24,25)2)34(3)21-19-28(37-40(5,6)7)32(39-42(11,12)13)27(34)22-29(31)38-41(8,9)10/h23-29,31-32H,14-22H2,1-13H3/t23?,24-,25?,26?,27-,28+,29?,31?,32-,33-,34-/m1/s1 |
| InChIKey | XLJGJNLLTFGMTL-WVAZCJNPSA-N |
| XLogP | 9.11 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.16 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|