C30H52O5Si — CID 156787296
methyl (4R)-4-[(5R,7R,8R,9S,10S,13R,14S,17R)-7-(methoxymethoxy)-10,13-dimethyl-3-trimethylsilyloxy-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 156787296) has the molecular formula C30H52O5Si and a molecular weight of 520.83 g/mol. Its IUPAC name is methyl (4R)-4-[(5R,7R,8R,9S,10S,13R,14S,17R)-7-(methoxymethoxy)-10,13-dimethyl-3-trimethylsilyloxy-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(5R,7R,8R,9S,10S,13R,14S,17R)-7-(methoxymethoxy)-10,13-dimethyl-3-trimethylsilyloxy-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 156787296 |
| Molecular Formula | C30H52O5Si |
| Molecular Weight | 520.83 g/mol |
| Exact Mass | 520.36 |
| IUPAC Name | methyl (4R)-4-[(5R,7R,8R,9S,10S,13R,14S,17R)-7-(methoxymethoxy)-10,13-dimethyl-3-trimethylsilyloxy-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COCO[C@@H]1C[C@@H]2CC(O[Si](C)(C)C)=CC[C@]2(C)[C@H]2CC[C@]3(C)[C@@H]([C@H](C)CCC(=O)OC)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C30H52O5Si/c1-20(9-12-27(31)33-5)23-10-11-24-28-25(14-16-30(23,24)3)29(2)15-13-22(35-36(6,7)8)17-21(29)18-26(28)34-19-32-4/h13,20-21,23-26,28H,9-12,14-19H2,1-8H3/t20-,21+,23-,24+,25+,26-,28+,29+,30-/m1/s1 |
| InChIKey | QSCRPSLVVOBZRQ-SRYPDPBBSA-N |
| XLogP | 7.18 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.83 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|