C27H43FO5 — CID 164703343
methyl (4R)-4-[(2S,5R,7R,10S,13R,17R)-2-fluoro-7-(methoxymethoxy)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 164703343) has the molecular formula C27H43FO5 and a molecular weight of 466.63 g/mol. Its IUPAC name is methyl (4R)-4-[(2S,5R,7R,10S,13R,17R)-2-fluoro-7-(methoxymethoxy)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(2S,5R,7R,10S,13R,17R)-2-fluoro-7-(methoxymethoxy)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 164703343 |
| Molecular Formula | C27H43FO5 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | methyl (4R)-4-[(2S,5R,7R,10S,13R,17R)-2-fluoro-7-(methoxymethoxy)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COCOC1C[C@@H]2CC(=O)[C@@H](F)C[C@]2(C)C2CC[C@@]3(C)C(CC[C@@H]3[C@H](C)CCC(=O)OC)C12 |
| InChI | InChI=1S/C27H43FO5/c1-16(6-9-24(30)32-5)18-7-8-19-25-20(10-11-26(18,19)2)27(3)14-21(28)22(29)12-17(27)13-23(25)33-15-31-4/h16-21,23,25H,6-15H2,1-5H3/t16-,17+,18-,19?,20?,21+,23?,25?,26-,27+/m1/s1 |
| InChIKey | FPJZXHXFRLDVLN-GSTRRFHCSA-N |
| XLogP | 5.35 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|