C26H42O5 — CID 155645115
(4R)-4-[(5S,7R,8R,9S,10S,13R,14S,17R)-7-(methoxymethoxy)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 155645115) has the molecular formula C26H42O5 and a molecular weight of 434.62 g/mol. Its IUPAC name is (4R)-4-[(5S,7R,8R,9S,10S,13R,14S,17R)-7-(methoxymethoxy)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | (4R)-4-[(5S,7R,8R,9S,10S,13R,14S,17R)-7-(methoxymethoxy)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 155645115 |
| Molecular Formula | C26H42O5 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | (4R)-4-[(5S,7R,8R,9S,10S,13R,14S,17R)-7-(methoxymethoxy)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | COCO[C@@H]1C[C@H]2CC(=O)CC[C@]2(C)[C@H]2CC[C@]3(C)[C@@H]([C@H](C)CCC(=O)O)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C26H42O5/c1-16(5-8-23(28)29)19-6-7-20-24-21(10-12-26(19,20)3)25(2)11-9-18(27)13-17(25)14-22(24)31-15-30-4/h16-17,19-22,24H,5-15H2,1-4H3,(H,28,29)/t16-,17-,19-,20+,21+,22-,24+,25+,26-/m1/s1 |
| InChIKey | IHXJMOGZOJDWEY-GGXKNNFWSA-N |
| XLogP | 5.31 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|