C25H43O7P — CID 153348988
(4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-7-(phosphonooxymethoxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 153348988) has the molecular formula C25H43O7P and a molecular weight of 486.59 g/mol. Its IUPAC name is (4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-7-(phosphonooxymethoxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | (4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-7-(phosphonooxymethoxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 153348988 |
| Molecular Formula | C25H43O7P |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | (4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-7-(phosphonooxymethoxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | C[C@H](CCC(=O)O)[C@H]1CC[C@H]2[C@@H]3C(OCOP(=O)(O)O)C[C@@H]4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H43O7P/c1-16(7-10-22(26)27)18-8-9-19-23-20(11-13-25(18,19)3)24(2)12-5-4-6-17(24)14-21(23)31-15-32-33(28,29)30/h16-21,23H,4-15H2,1-3H3,(H,26,27)(H2,28,29,30)/t16-,17+,18-,19+,20+,21?,23+,24+,25-/m1/s1 |
| InChIKey | LVKKSVPSXYQVCL-DLQLUPPKSA-N |
| XLogP | 5.60 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|