C30H53O8P — CID 134253565
phosphonooxymethyl 4-(7-ethoxy-10,13-dimethyl-3-propan-2-yloxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate (PubChem CID 134253565) has the molecular formula C30H53O8P and a molecular weight of 572.72 g/mol. Its IUPAC name is phosphonooxymethyl 4-(7-ethoxy-10,13-dimethyl-3-propan-2-yloxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate.
| Compound Name | phosphonooxymethyl 4-(7-ethoxy-10,13-dimethyl-3-propan-2-yloxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate |
|---|---|
| PubChem CID | 134253565 |
| Molecular Formula | C30H53O8P |
| Molecular Weight | 572.72 g/mol |
| Exact Mass | 572.35 |
| IUPAC Name | phosphonooxymethyl 4-(7-ethoxy-10,13-dimethyl-3-propan-2-yloxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate |
| SMILES | CCOC1CC2CC(OC(C)C)CCC2(C)C2CCC3(C)C(C(C)CCC(=O)OCOP(=O)(O)O)CCC3C12 |
| InChI | InChI=1S/C30H53O8P/c1-7-35-26-17-21-16-22(38-19(2)3)12-14-29(21,5)25-13-15-30(6)23(9-10-24(30)28(25)26)20(4)8-11-27(31)36-18-37-39(32,33)34/h19-26,28H,7-18H2,1-6H3,(H2,32,33,34) |
| InChIKey | OEQBREAJIFNQBM-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.72 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|