C29H52NO10PS — CID 134253574
phosphonooxymethyl 2-[4-(7-ethoxy-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]ethanesulfonate (PubChem CID 134253574) has the molecular formula C29H52NO10PS and a molecular weight of 637.77 g/mol. Its IUPAC name is phosphonooxymethyl 2-[4-(7-ethoxy-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]ethanesulfonate.
| Compound Name | phosphonooxymethyl 2-[4-(7-ethoxy-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]ethanesulfonate |
|---|---|
| PubChem CID | 134253574 |
| Molecular Formula | C29H52NO10PS |
| Molecular Weight | 637.77 g/mol |
| Exact Mass | 637.30 |
| IUPAC Name | phosphonooxymethyl 2-[4-(7-ethoxy-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]ethanesulfonate |
| SMILES | CCOC1CC2CC(O)CCC2(C)C2CCC3(C)C(C(C)CCC(=O)NCCS(=O)(=O)OCOP(=O)(O)O)CCC3C12 |
| InChI | InChI=1S/C29H52NO10PS/c1-5-38-25-17-20-16-21(31)10-12-28(20,3)24-11-13-29(4)22(7-8-23(29)27(24)25)19(2)6-9-26(32)30-14-15-42(36,37)40-18-39-41(33,34)35/h19-25,27,31H,5-18H2,1-4H3,(H,30,32)(H2,33,34,35) |
| InChIKey | XKBKVGQNSUMUIX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 168.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.77 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|