C25H43O6P — CID 146665187
methyl (4R)-4-[(7R,9S,14S)-10,13-dimethyl-7-phosphonooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 146665187) has the molecular formula C25H43O6P and a molecular weight of 470.59 g/mol. Its IUPAC name is methyl (4R)-4-[(7R,9S,14S)-10,13-dimethyl-7-phosphonooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(7R,9S,14S)-10,13-dimethyl-7-phosphonooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 146665187 |
| Molecular Formula | C25H43O6P |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | methyl (4R)-4-[(7R,9S,14S)-10,13-dimethyl-7-phosphonooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)C1CC[C@H]2C3C(OP(=O)(O)O)CC4CCCCC4(C)[C@H]3CCC12C |
| InChI | InChI=1S/C25H43O6P/c1-16(8-11-22(26)30-4)18-9-10-19-23-20(12-14-25(18,19)3)24(2)13-6-5-7-17(24)15-21(23)31-32(27,28)29/h16-21,23H,5-15H2,1-4H3,(H2,27,28,29)/t16-,17?,18?,19+,20+,21?,23?,24?,25?/m1/s1 |
| InChIKey | YWGNHXVIBNLIEO-ONBNUUMPSA-N |
| XLogP | 5.71 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|