C26H44O3 — CID 140901429
methyl (4R)-4-[(2S,5R,7R,11R,12S,15R,16R)-5-hydroxy-2,16-dimethyl-15-tetracyclo[9.7.0.02,7.012,16]octadecanyl]pentanoate (PubChem CID 140901429) has the molecular formula C26H44O3 and a molecular weight of 404.64 g/mol. Its IUPAC name is methyl (4R)-4-[(2S,5R,7R,11R,12S,15R,16R)-5-hydroxy-2,16-dimethyl-15-tetracyclo[9.7.0.02,7.012,16]octadecanyl]pentanoate.
| Compound Name | methyl (4R)-4-[(2S,5R,7R,11R,12S,15R,16R)-5-hydroxy-2,16-dimethyl-15-tetracyclo[9.7.0.02,7.012,16]octadecanyl]pentanoate |
|---|---|
| PubChem CID | 140901429 |
| Molecular Formula | C26H44O3 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.33 |
| IUPAC Name | methyl (4R)-4-[(2S,5R,7R,11R,12S,15R,16R)-5-hydroxy-2,16-dimethyl-15-tetracyclo[9.7.0.02,7.012,16]octadecanyl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC[C@@H]4C[C@H](O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C26H44O3/c1-17(8-11-24(28)29-4)21-9-10-22-20-7-5-6-18-16-19(27)12-14-25(18,2)23(20)13-15-26(21,22)3/h17-23,27H,5-16H2,1-4H3/t17-,18-,19-,20+,21-,22+,23?,25+,26-/m1/s1 |
| InChIKey | CYCUXLNARQPGPL-AWCCYIHTSA-N |
| XLogP | 5.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |