C25H42O3 — CID 126640962
(4R)-4-[(2S,5R,7R,11R,15R,16R)-5-hydroxy-2,16-dimethyl-15-tetracyclo[9.7.0.02,7.012,16]octadecanyl]pentanoic acid (PubChem CID 126640962) has the molecular formula C25H42O3 and a molecular weight of 390.61 g/mol. Its IUPAC name is (4R)-4-[(2S,5R,7R,11R,15R,16R)-5-hydroxy-2,16-dimethyl-15-tetracyclo[9.7.0.02,7.012,16]octadecanyl]pentanoic acid.
| Compound Name | (4R)-4-[(2S,5R,7R,11R,15R,16R)-5-hydroxy-2,16-dimethyl-15-tetracyclo[9.7.0.02,7.012,16]octadecanyl]pentanoic acid |
|---|---|
| PubChem CID | 126640962 |
| Molecular Formula | C25H42O3 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | (4R)-4-[(2S,5R,7R,11R,15R,16R)-5-hydroxy-2,16-dimethyl-15-tetracyclo[9.7.0.02,7.012,16]octadecanyl]pentanoic acid |
| SMILES | C[C@H](CCC(=O)O)[C@H]1CCC2[C@@H]3CCC[C@@H]4C[C@H](O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C25H42O3/c1-16(7-10-23(27)28)20-8-9-21-19-6-4-5-17-15-18(26)11-13-24(17,2)22(19)12-14-25(20,21)3/h16-22,26H,4-15H2,1-3H3,(H,27,28)/t16-,17-,18-,19+,20-,21?,22?,24+,25-/m1/s1 |
| InChIKey | MYILIGMOHOFAOS-YEPLMJIYSA-N |
| XLogP | 5.90 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |