C30H50O4 — CID 134179216
methyl (4R)-4-[(10S,13R)-10,13-dimethyl-7-(oxan-2-yloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 134179216) has the molecular formula C30H50O4 and a molecular weight of 474.73 g/mol. Its IUPAC name is methyl (4R)-4-[(10S,13R)-10,13-dimethyl-7-(oxan-2-yloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(10S,13R)-10,13-dimethyl-7-(oxan-2-yloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 134179216 |
| Molecular Formula | C30H50O4 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | methyl (4R)-4-[(10S,13R)-10,13-dimethyl-7-(oxan-2-yloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)C1CCC2C3C(OC4CCCCO4)CC4CCCC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C30H50O4/c1-20(11-14-26(31)32-4)22-12-13-23-28-24(15-17-30(22,23)3)29(2)16-7-5-9-21(29)19-25(28)34-27-10-6-8-18-33-27/h20-25,27-28H,5-19H2,1-4H3/t20-,21?,22?,23?,24?,25?,27?,28?,29+,30-/m1/s1 |
| InChIKey | ZCRCWHVHMMBMEM-BNANAHSESA-N |
| XLogP | 7.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|