C30H48O6 — CID 71111908
methyl 4-[(7R,10S,12S,13R)-12-hydroxy-10,13-dimethyl-7-(oxan-2-yloxy)-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 71111908) has the molecular formula C30H48O6 and a molecular weight of 504.71 g/mol. Its IUPAC name is methyl 4-[(7R,10S,12S,13R)-12-hydroxy-10,13-dimethyl-7-(oxan-2-yloxy)-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl 4-[(7R,10S,12S,13R)-12-hydroxy-10,13-dimethyl-7-(oxan-2-yloxy)-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 71111908 |
| Molecular Formula | C30H48O6 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.35 |
| IUPAC Name | methyl 4-[(7R,10S,12S,13R)-12-hydroxy-10,13-dimethyl-7-(oxan-2-yloxy)-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CCC(C)C1CCC2C3C(OC4CCCCO4)CC4CC(=O)CC[C@]4(C)C3C[C@H](O)[C@]12C |
| InChI | InChI=1S/C30H48O6/c1-18(8-11-26(33)34-4)21-9-10-22-28-23(17-25(32)30(21,22)3)29(2)13-12-20(31)15-19(29)16-24(28)36-27-7-5-6-14-35-27/h18-19,21-25,27-28,32H,5-17H2,1-4H3/t18?,19?,21?,22?,23?,24?,25-,27?,28?,29-,30+/m0/s1 |
| InChIKey | RPFDQUMUWVQPQR-FCBBVELPSA-N |
| XLogP | 5.30 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|