C29H48O7 — CID 11785491
methyl (4R)-4-[(5R,7R,8R,9S,10S,12S,13R,14S,17R)-7,12-bis(methoxymethoxy)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 11785491) has the molecular formula C29H48O7 and a molecular weight of 508.70 g/mol. Its IUPAC name is methyl (4R)-4-[(5R,7R,8R,9S,10S,12S,13R,14S,17R)-7,12-bis(methoxymethoxy)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(5R,7R,8R,9S,10S,12S,13R,14S,17R)-7,12-bis(methoxymethoxy)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 11785491 |
| Molecular Formula | C29H48O7 |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.34 |
| IUPAC Name | methyl (4R)-4-[(5R,7R,8R,9S,10S,12S,13R,14S,17R)-7,12-bis(methoxymethoxy)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COCO[C@H]1C[C@H]2[C@@H]([C@H](OCOC)C[C@@H]3CC(=O)CC[C@@]32C)[C@@H]2CC[C@H]([C@H](C)CCC(=O)OC)[C@@]12C |
| InChI | InChI=1S/C29H48O7/c1-18(7-10-26(31)34-6)21-8-9-22-27-23(15-25(29(21,22)3)36-17-33-5)28(2)12-11-20(30)13-19(28)14-24(27)35-16-32-4/h18-19,21-25,27H,7-17H2,1-6H3/t18-,19+,21-,22+,23+,24-,25+,27+,28+,29-/m1/s1 |
| InChIKey | IPVXAACAMPYFBA-ZPTOEARBSA-N |
| XLogP | 5.00 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|