C37H52O7 — CID 75991943
[17-(5-methoxy-5-oxopentan-2-yl)-10,13-dimethyl-7-(oxan-2-yloxy)-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-12-yl] benzoate (PubChem CID 75991943) has the molecular formula C37H52O7 and a molecular weight of 608.82 g/mol. Its IUPAC name is [17-(5-methoxy-5-oxopentan-2-yl)-10,13-dimethyl-7-(oxan-2-yloxy)-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-12-yl] benzoate.
| Compound Name | [17-(5-methoxy-5-oxopentan-2-yl)-10,13-dimethyl-7-(oxan-2-yloxy)-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-12-yl] benzoate |
|---|---|
| PubChem CID | 75991943 |
| Molecular Formula | C37H52O7 |
| Molecular Weight | 608.82 g/mol |
| Exact Mass | 608.37 |
| IUPAC Name | [17-(5-methoxy-5-oxopentan-2-yl)-10,13-dimethyl-7-(oxan-2-yloxy)-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-12-yl] benzoate |
| SMILES | COC(=O)CCC(C)C1CCC2C3C(OC4CCCCO4)CC4CC(=O)CCC4(C)C3CC(OC(=O)c3ccccc3)C12C |
| InChI | InChI=1S/C37H52O7/c1-23(13-16-32(39)41-4)27-14-15-28-34-29(22-31(37(27,28)3)44-35(40)24-10-6-5-7-11-24)36(2)18-17-26(38)20-25(36)21-30(34)43-33-12-8-9-19-42-33/h5-7,10-11,23,25,27-31,33-34H,8-9,12-22H2,1-4H3 |
| InChIKey | KKLZHNFVPMJKRV-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.82 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|