C28H42O7 — CID 102184946
3-[[(8R,9S,10S,12S,13R,14S,17R)-17-[(2R)-5-methoxy-5-oxopentan-2-yl]-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-12-yl]oxy]-3-oxopropanoic acid (PubChem CID 102184946) has the molecular formula C28H42O7 and a molecular weight of 490.64 g/mol. Its IUPAC name is 3-[[(8R,9S,10S,12S,13R,14S,17R)-17-[(2R)-5-methoxy-5-oxopentan-2-yl]-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-12-yl]oxy]-3-oxopropanoic acid.
| Compound Name | 3-[[(8R,9S,10S,12S,13R,14S,17R)-17-[(2R)-5-methoxy-5-oxopentan-2-yl]-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-12-yl]oxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 102184946 |
| Molecular Formula | C28H42O7 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | 3-[[(8R,9S,10S,12S,13R,14S,17R)-17-[(2R)-5-methoxy-5-oxopentan-2-yl]-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-12-yl]oxy]-3-oxopropanoic acid |
| SMILES | COC(=O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4CC(=O)CC[C@]4(C)[C@H]3C[C@H](OC(=O)CC(=O)O)[C@]12C |
| InChI | InChI=1S/C28H42O7/c1-16(5-10-25(32)34-4)20-8-9-21-19-7-6-17-13-18(29)11-12-27(17,2)22(19)14-23(28(20,21)3)35-26(33)15-24(30)31/h16-17,19-23H,5-15H2,1-4H3,(H,30,31)/t16-,17?,19+,20-,21+,22+,23+,27+,28-/m1/s1 |
| InChIKey | HPWSLDYMFAZKDC-VWCKBGLCSA-N |
| XLogP | 4.80 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|