C29H52O3 — CID 145266335
ethane;methyl (4R)-4-(10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoate (PubChem CID 145266335) has the molecular formula C29H52O3 and a molecular weight of 448.73 g/mol. Its IUPAC name is ethane;methyl (4R)-4-(10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoate.
| Compound Name | ethane;methyl (4R)-4-(10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoate |
|---|---|
| PubChem CID | 145266335 |
| Molecular Formula | C29H52O3 |
| Molecular Weight | 448.73 g/mol |
| Exact Mass | 448.39 |
| IUPAC Name | ethane;methyl (4R)-4-(10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoate |
| SMILES | CC.CC.COC(=O)CC[C@@H](C)C1CCC2C3CCC4CC(=O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C25H40O3.2C2H6/c1-16(5-10-23(27)28-4)20-8-9-21-19-7-6-17-15-18(26)11-13-24(17,2)22(19)12-14-25(20,21)3;2*1-2/h16-17,19-22H,5-15H2,1-4H3;2*1-2H3/t16-,17?,19?,20?,21?,22?,24?,25?;;/m1../s1 |
| InChIKey | AGAHOELQVFQDDK-YFFHEPHMSA-N |
| XLogP | 7.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.73 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |