C26H42O3 — CID 23400079
methyl 5-(10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)hexanoate (PubChem CID 23400079) has the molecular formula C26H42O3 and a molecular weight of 402.62 g/mol. Its IUPAC name is methyl 5-(10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)hexanoate.
| Compound Name | methyl 5-(10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)hexanoate |
|---|---|
| PubChem CID | 23400079 |
| Molecular Formula | C26H42O3 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | methyl 5-(10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)hexanoate |
| SMILES | COC(=O)CCCC(C)C1CCC2C3CCC4CC(=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C26H42O3/c1-17(6-5-7-24(28)29-4)21-10-11-22-20-9-8-18-16-19(27)12-14-25(18,2)23(20)13-15-26(21,22)3/h17-18,20-23H,5-16H2,1-4H3 |
| InChIKey | NNAROCIJTAGDCC-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |