C27H42O2S — CID 142025714
10,13-dimethyl-17-(5-oxo-7-sulfanylideneoctan-2-yl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 142025714) has the molecular formula C27H42O2S and a molecular weight of 430.70 g/mol. Its IUPAC name is 10,13-dimethyl-17-(5-oxo-7-sulfanylideneoctan-2-yl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 10,13-dimethyl-17-(5-oxo-7-sulfanylideneoctan-2-yl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 142025714 |
| Molecular Formula | C27H42O2S |
| Molecular Weight | 430.70 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | 10,13-dimethyl-17-(5-oxo-7-sulfanylideneoctan-2-yl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(=S)CC(=O)CCC(C)C1CCC2C3CCC4CC(=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C27H42O2S/c1-17(5-7-20(28)15-18(2)30)23-9-10-24-22-8-6-19-16-21(29)11-13-26(19,3)25(22)12-14-27(23,24)4/h17,19,22-25H,5-16H2,1-4H3 |
| InChIKey | GITKLYITSLTHQC-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.70 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|