C29H50ClNO2 — CID 142025722
N-(2-chloroethyl)-4-(10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanamide;propane (PubChem CID 142025722) has the molecular formula C29H50ClNO2 and a molecular weight of 480.18 g/mol. Its IUPAC name is N-(2-chloroethyl)-4-(10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanamide;propane.
| Compound Name | N-(2-chloroethyl)-4-(10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanamide;propane |
|---|---|
| PubChem CID | 142025722 |
| Molecular Formula | C29H50ClNO2 |
| Molecular Weight | 480.18 g/mol |
| Exact Mass | 479.35 |
| IUPAC Name | N-(2-chloroethyl)-4-(10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanamide;propane |
| SMILES | CC(CCC(=O)NCCCl)C1CCC2C3CCC4CC(=O)CCC4(C)C3CCC12C.CCC |
| InChI | InChI=1S/C26H42ClNO2.C3H8/c1-17(4-9-24(30)28-15-14-27)21-7-8-22-20-6-5-18-16-19(29)10-12-25(18,2)23(20)11-13-26(21,22)3;1-3-2/h17-18,20-23H,4-16H2,1-3H3,(H,28,30);3H2,1-2H3 |
| InChIKey | ZDGIEDLHUWTXBD-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.18 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|