C27H41BrO5 — CID 124922202
methyl (4R)-4-[(4S,5R,8S,9R,10R,12R,13R,14R,17S)-12-acetyloxy-4-bromo-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 124922202) has the molecular formula C27H41BrO5 and a molecular weight of 525.52 g/mol. Its IUPAC name is methyl (4R)-4-[(4S,5R,8S,9R,10R,12R,13R,14R,17S)-12-acetyloxy-4-bromo-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(4S,5R,8S,9R,10R,12R,13R,14R,17S)-12-acetyloxy-4-bromo-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 124922202 |
| Molecular Formula | C27H41BrO5 |
| Molecular Weight | 525.52 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | methyl (4R)-4-[(4S,5R,8S,9R,10R,12R,13R,14R,17S)-12-acetyloxy-4-bromo-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)[C@@H]1CC[C@@H]2[C@H]3CC[C@H]4[C@H](Br)C(=O)CC[C@]4(C)[C@@H]3C[C@@H](OC(C)=O)[C@@]21C |
| InChI | InChI=1S/C27H41BrO5/c1-15(6-11-24(31)32-5)18-9-10-19-17-7-8-20-25(28)22(30)12-13-26(20,3)21(17)14-23(27(18,19)4)33-16(2)29/h15,17-21,23,25H,6-14H2,1-5H3/t15-,17-,18+,19-,20+,21-,23-,25+,26+,27-/m1/s1 |
| InChIKey | YNWYOSBEGUAVTN-GCXIURDESA-N |
| XLogP | 5.72 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|