C29H48O6 — CID 125031954
methyl (4R)-4-[(5R,8R,9R,10S,12S,13R,14R,17S)-12-acetyloxy-3,3-dimethoxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 125031954) has the molecular formula C29H48O6 and a molecular weight of 492.70 g/mol. Its IUPAC name is methyl (4R)-4-[(5R,8R,9R,10S,12S,13R,14R,17S)-12-acetyloxy-3,3-dimethoxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(5R,8R,9R,10S,12S,13R,14R,17S)-12-acetyloxy-3,3-dimethoxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 125031954 |
| Molecular Formula | C29H48O6 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.35 |
| IUPAC Name | methyl (4R)-4-[(5R,8R,9R,10S,12S,13R,14R,17S)-12-acetyloxy-3,3-dimethoxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)[C@@H]1CC[C@@H]2[C@@H]3CC[C@@H]4CC(OC)(OC)CC[C@]4(C)[C@@H]3C[C@H](OC(C)=O)[C@@]21C |
| InChI | InChI=1S/C29H48O6/c1-18(8-13-26(31)32-5)22-11-12-23-21-10-9-20-17-29(33-6,34-7)15-14-27(20,3)24(21)16-25(28(22,23)4)35-19(2)30/h18,20-25H,8-17H2,1-7H3/t18-,20-,21+,22+,23-,24-,25+,27+,28-/m1/s1 |
| InChIKey | TYQHGEKPIMDGRE-METUTDSDSA-N |
| XLogP | 5.77 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|