C32H50O8 — CID 23631371
CID 23631371 (PubChem CID 23631371) has the molecular formula C32H50O8 and a molecular weight of 562.74 g/mol.
| Compound Name | CID 23631371 |
|---|---|
| PubChem CID | 23631371 |
| Molecular Formula | C32H50O8 |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.35 |
| IUPAC Name | — |
| SMILES | CC(=O)O[C@H]1C[C@H]2[C@@H](CC[C@@H]3CC4(CC[C@@]32C)OOC2(CCCCC2)OO4)[C@@H]2CC[C@H]([C@H](C)CCC(=O)O)[C@@]12C |
| InChI | InChI=1S/C32H50O8/c1-20(8-13-28(34)35)24-11-12-25-23-10-9-22-19-32(39-37-31(38-40-32)14-6-5-7-15-31)17-16-29(22,3)26(23)18-27(30(24,25)4)36-21(2)33/h20,22-27H,5-19H2,1-4H3,(H,34,35)/t20-,22-,23+,24-,25+,26+,27+,29+,30-/m1/s1 |
| InChIKey | CHLMOZPCWMPLKG-YSSIKYIBSA-N |
| XLogP | 6.95 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|