C37H59NO9 — CID 20801319
CID 20801319 (PubChem CID 20801319) has the molecular formula C37H59NO9 and a molecular weight of 661.88 g/mol.
| Compound Name | CID 20801319 |
|---|---|
| PubChem CID | 20801319 |
| Molecular Formula | C37H59NO9 |
| Molecular Weight | 661.88 g/mol |
| Exact Mass | 661.42 |
| IUPAC Name | — |
| SMILES | CCNC(=O)CCC(C)C1CCC2C3C(OC(C)=O)CC4CC5(CCC4(C)C3CC(OC(C)=O)C12C)OOC1(CCC(C)CC1)OO5 |
| InChI | InChI=1S/C37H59NO9/c1-8-38-32(41)12-9-23(3)27-10-11-28-33-29(20-31(35(27,28)7)43-25(5)40)34(6)17-18-37(21-26(34)19-30(33)42-24(4)39)46-44-36(45-47-37)15-13-22(2)14-16-36/h22-23,26-31,33H,8-21H2,1-7H3,(H,38,41) |
| InChIKey | LFYVETSPEPPKAU-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.88 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|