C32H50O6 — CID 67457491
(4R)-4-[(5S,8R,9S,10S,12S,13R,14S,17R)-10,13-dimethyl-12-[2,2,2-tris(ethenoxy)ethoxy]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 67457491) has the molecular formula C32H50O6 and a molecular weight of 530.75 g/mol. Its IUPAC name is (4R)-4-[(5S,8R,9S,10S,12S,13R,14S,17R)-10,13-dimethyl-12-[2,2,2-tris(ethenoxy)ethoxy]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | (4R)-4-[(5S,8R,9S,10S,12S,13R,14S,17R)-10,13-dimethyl-12-[2,2,2-tris(ethenoxy)ethoxy]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 67457491 |
| Molecular Formula | C32H50O6 |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | (4R)-4-[(5S,8R,9S,10S,12S,13R,14S,17R)-10,13-dimethyl-12-[2,2,2-tris(ethenoxy)ethoxy]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | C=COC(CO[C@H]1C[C@H]2[C@@H](CC[C@@H]3CCCC[C@@]32C)[C@@H]2CC[C@H]([C@H](C)CCC(=O)O)[C@@]12C)(OC=C)OC=C |
| InChI | InChI=1S/C32H50O6/c1-7-36-32(37-8-2,38-9-3)21-35-28-20-27-24(15-14-23-12-10-11-19-30(23,27)5)26-17-16-25(31(26,28)6)22(4)13-18-29(33)34/h7-9,22-28H,1-3,10-21H2,4-6H3,(H,33,34)/t22-,23+,24+,25-,26+,27+,28+,30+,31-/m1/s1 |
| InChIKey | MXPKJXVAMPUVKW-SRDZJQJYSA-N |
| XLogP | 7.67 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|