C26H41BrO3 — CID 139575099
ethyl (4R)-4-[(5S,10R,13R)-4-bromo-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 139575099) has the molecular formula C26H41BrO3 and a molecular weight of 481.52 g/mol. Its IUPAC name is ethyl (4R)-4-[(5S,10R,13R)-4-bromo-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | ethyl (4R)-4-[(5S,10R,13R)-4-bromo-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 139575099 |
| Molecular Formula | C26H41BrO3 |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | ethyl (4R)-4-[(5S,10R,13R)-4-bromo-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | CCOC(=O)CC[C@@H](C)C1CCC2C3CC[C@@H]4C(Br)C(=O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C26H41BrO3/c1-5-30-23(29)11-6-16(2)18-9-10-19-17-7-8-21-24(27)22(28)13-15-26(21,4)20(17)12-14-25(18,19)3/h16-21,24H,5-15H2,1-4H3/t16-,17?,18?,19?,20?,21-,24?,25-,26-/m1/s1 |
| InChIKey | BEBFONRCFYRBME-QNWDGFIFSA-N |
| XLogP | 6.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|