C19H29BrO2 — CID 2748147
(5S)-4-bromo-17-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 2748147) has the molecular formula C19H29BrO2 and a molecular weight of 369.34 g/mol. Its IUPAC name is (5S)-4-bromo-17-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (5S)-4-bromo-17-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 2748147 |
| Molecular Formula | C19H29BrO2 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (5S)-4-bromo-17-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC12CCC3C(CC[C@@H]4C(Br)C(=O)CCC34C)C1CCC2O |
| InChI | InChI=1S/C19H29BrO2/c1-18-10-8-15(21)17(20)14(18)4-3-11-12-5-6-16(22)19(12,2)9-7-13(11)18/h11-14,16-17,22H,3-10H2,1-2H3/t11?,12?,13?,14-,16?,17?,18?,19?/m1/s1 |
| InChIKey | XNFPSGMHGPKVAT-ASLRQGQZSA-N |
| XLogP | 4.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|