C27H40O5 — CID 170908044
methyl (4R)-4-[(3R,3aR,4S,6R)-4-acetyloxy-6-but-3-ynyl-3a,6-dimethyl-7-oxo-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-yl]pentanoate (PubChem CID 170908044) has the molecular formula C27H40O5 and a molecular weight of 444.61 g/mol. Its IUPAC name is methyl (4R)-4-[(3R,3aR,4S,6R)-4-acetyloxy-6-but-3-ynyl-3a,6-dimethyl-7-oxo-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(3R,3aR,4S,6R)-4-acetyloxy-6-but-3-ynyl-3a,6-dimethyl-7-oxo-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-yl]pentanoate |
|---|---|
| PubChem CID | 170908044 |
| Molecular Formula | C27H40O5 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | methyl (4R)-4-[(3R,3aR,4S,6R)-4-acetyloxy-6-but-3-ynyl-3a,6-dimethyl-7-oxo-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-yl]pentanoate |
| SMILES | C#CCC[C@@]1(C)C(=O)CCC2C3CC[C@H]([C@H](C)CCC(=O)OC)[C@@]3(C)[C@@H](OC(C)=O)CC21 |
| InChI | InChI=1S/C27H40O5/c1-7-8-15-26(4)22-16-24(32-18(3)28)27(5)20(17(2)9-14-25(30)31-6)11-12-21(27)19(22)10-13-23(26)29/h1,17,19-22,24H,8-16H2,2-6H3/t17-,19?,20-,21?,22?,24+,26-,27-/m1/s1 |
| InChIKey | IFZDCUYBLNVFHH-SVWWGUJSSA-N |
| XLogP | 4.96 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|