C26H44O5S — CID 23253225
methyl (4R)-4-[(5S,7R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-7-methylsulfonyloxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 23253225) has the molecular formula C26H44O5S and a molecular weight of 468.70 g/mol. Its IUPAC name is methyl (4R)-4-[(5S,7R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-7-methylsulfonyloxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(5S,7R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-7-methylsulfonyloxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 23253225 |
| Molecular Formula | C26H44O5S |
| Molecular Weight | 468.70 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | methyl (4R)-4-[(5S,7R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-7-methylsulfonyloxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3[C@H](OS(C)(=O)=O)C[C@@H]4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H44O5S/c1-17(9-12-23(27)30-4)19-10-11-20-24-21(13-15-26(19,20)3)25(2)14-7-6-8-18(25)16-22(24)31-32(5,28)29/h17-22,24H,6-16H2,1-5H3/t17-,18+,19-,20+,21+,22-,24+,25+,26-/m1/s1 |
| InChIKey | GQXUQZSMJNZFOS-DDVQXDAKSA-N |
| XLogP | 5.58 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.70 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|