C28H48O4 — CID 134253549
4-(3,7-diethoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoic acid (PubChem CID 134253549) has the molecular formula C28H48O4 and a molecular weight of 448.69 g/mol. Its IUPAC name is 4-(3,7-diethoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoic acid.
| Compound Name | 4-(3,7-diethoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoic acid |
|---|---|
| PubChem CID | 134253549 |
| Molecular Formula | C28H48O4 |
| Molecular Weight | 448.69 g/mol |
| Exact Mass | 448.36 |
| IUPAC Name | 4-(3,7-diethoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoic acid |
| SMILES | CCOC1CCC2(C)C(C1)CC(OCC)C1C2CCC2(C)C(C(C)CCC(=O)O)CCC12 |
| InChI | InChI=1S/C28H48O4/c1-6-31-20-12-14-27(4)19(16-20)17-24(32-7-2)26-22-10-9-21(18(3)8-11-25(29)30)28(22,5)15-13-23(26)27/h18-24,26H,6-17H2,1-5H3,(H,29,30) |
| InChIKey | WVFMGZYGJJYTSD-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.69 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |