C28H46F2O4 — CID 163640778
methyl (4R)-4-[(3R,5S,10S,13R,17R)-2,2-difluoro-7-(methoxymethoxy)-3,10,13-trimethyl-1,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 163640778) has the molecular formula C28H46F2O4 and a molecular weight of 484.67 g/mol. Its IUPAC name is methyl (4R)-4-[(3R,5S,10S,13R,17R)-2,2-difluoro-7-(methoxymethoxy)-3,10,13-trimethyl-1,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(3R,5S,10S,13R,17R)-2,2-difluoro-7-(methoxymethoxy)-3,10,13-trimethyl-1,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 163640778 |
| Molecular Formula | C28H46F2O4 |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.34 |
| IUPAC Name | methyl (4R)-4-[(3R,5S,10S,13R,17R)-2,2-difluoro-7-(methoxymethoxy)-3,10,13-trimethyl-1,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COCOC1C[C@@H]2C[C@@H](C)C(F)(F)C[C@]2(C)C2CC[C@@]3(C)C(CC[C@@H]3[C@H](C)CCC(=O)OC)C12 |
| InChI | InChI=1S/C28H46F2O4/c1-17(7-10-24(31)33-6)20-8-9-21-25-22(11-12-26(20,21)3)27(4)15-28(29,30)18(2)13-19(27)14-23(25)34-16-32-5/h17-23,25H,7-16H2,1-6H3/t17-,18-,19+,20-,21?,22?,23?,25?,26-,27+/m1/s1 |
| InChIKey | UPHRNONYRGVTIV-GVQQACQRSA-N |
| XLogP | 6.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|